C34H39NO5 — CID 162868824
11-hydroxy-1-[4-hydroxy-3-[2-[4-hydroxy-2-(1H-indol-5-yl)phenyl]ethoxy]phenyl]dodec-4-en-3-one (PubChem CID 162868824) has the molecular formula C34H39NO5 and a molecular weight of 541.69 g/mol. Its IUPAC name is 11-hydroxy-1-[4-hydroxy-3-[2-[4-hydroxy-2-(1H-indol-5-yl)phenyl]ethoxy]phenyl]dodec-4-en-3-one.
| Compound Name | 11-hydroxy-1-[4-hydroxy-3-[2-[4-hydroxy-2-(1H-indol-5-yl)phenyl]ethoxy]phenyl]dodec-4-en-3-one |
|---|---|
| PubChem CID | 162868824 |
| Molecular Formula | C34H39NO5 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 11-hydroxy-1-[4-hydroxy-3-[2-[4-hydroxy-2-(1H-indol-5-yl)phenyl]ethoxy]phenyl]dodec-4-en-3-one |
| SMILES | CC(O)CCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)cc2-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C34H39NO5/c1-24(36)7-5-3-2-4-6-8-29(37)13-9-25-10-16-33(39)34(21-25)40-20-18-26-11-14-30(38)23-31(26)27-12-15-32-28(22-27)17-19-35-32/h6,8,10-12,14-17,19,21-24,35-36,38-39H,2-5,7,9,13,18,20H2,1H3 |
| InChIKey | HPTHAFYSYHGQGX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|