C40H48N3O6- — CID 162972895
3-[4-(diaminomethyl)phenyl]-3-[2-hydroxy-5-[2-[2-hydroxy-5-(11-hydroxy-3-oxododec-4-enyl)phenoxy]ethyl]phenyl]-1-pyrrol-3-ylidenepropan-1-olate (PubChem CID 162972895) has the molecular formula C40H48N3O6- and a molecular weight of 666.84 g/mol. Its IUPAC name is 3-[4-(diaminomethyl)phenyl]-3-[2-hydroxy-5-[2-[2-hydroxy-5-(11-hydroxy-3-oxododec-4-enyl)phenoxy]ethyl]phenyl]-1-pyrrol-3-ylidenepropan-1-olate.
| Compound Name | 3-[4-(diaminomethyl)phenyl]-3-[2-hydroxy-5-[2-[2-hydroxy-5-(11-hydroxy-3-oxododec-4-enyl)phenoxy]ethyl]phenyl]-1-pyrrol-3-ylidenepropan-1-olate |
|---|---|
| PubChem CID | 162972895 |
| Molecular Formula | C40H48N3O6- |
| Molecular Weight | 666.84 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | 3-[4-(diaminomethyl)phenyl]-3-[2-hydroxy-5-[2-[2-hydroxy-5-(11-hydroxy-3-oxododec-4-enyl)phenoxy]ethyl]phenyl]-1-pyrrol-3-ylidenepropan-1-olate |
| SMILES | CC(O)CCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)c(C(CC([O-])=C3C=CN=C3)c3ccc(C(N)N)cc3)c2)c1 |
| InChI | InChI=1S/C40H49N3O6/c1-27(44)7-5-3-2-4-6-8-33(45)16-9-28-11-18-37(47)39(24-28)49-22-20-29-10-17-36(46)35(23-29)34(25-38(48)32-19-21-43-26-32)30-12-14-31(15-13-30)40(41)42/h6,8,10-15,17-19,21,23-24,26-27,34,40,44,46-48H,2-5,7,9,16,20,22,25,41-42H2,1H3/p-1 |
| InChIKey | BGYZITBIQFTOOZ-UHFFFAOYSA-M |
| XLogP | 5.76 |
| TPSA | 174.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|