C46H52N2O5 — CID 163006350
(9R)-1-[3-[2-[3-[[4-(diaminomethyl)phenyl]methyl]-4-hydroxy-2-(4-hydroxyphenyl)phenyl]ethoxy]-4-hydroxyphenyl]-9-methyl-11-phenylundec-4-en-3-one (PubChem CID 163006350) has the molecular formula C46H52N2O5 and a molecular weight of 712.93 g/mol. Its IUPAC name is (9R)-1-[3-[2-[3-[[4-(diaminomethyl)phenyl]methyl]-4-hydroxy-2-(4-hydroxyphenyl)phenyl]ethoxy]-4-hydroxyphenyl]-9-methyl-11-phenylundec-4-en-3-one.
| Compound Name | (9R)-1-[3-[2-[3-[[4-(diaminomethyl)phenyl]methyl]-4-hydroxy-2-(4-hydroxyphenyl)phenyl]ethoxy]-4-hydroxyphenyl]-9-methyl-11-phenylundec-4-en-3-one |
|---|---|
| PubChem CID | 163006350 |
| Molecular Formula | C46H52N2O5 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.39 |
| IUPAC Name | (9R)-1-[3-[2-[3-[[4-(diaminomethyl)phenyl]methyl]-4-hydroxy-2-(4-hydroxyphenyl)phenyl]ethoxy]-4-hydroxyphenyl]-9-methyl-11-phenylundec-4-en-3-one |
| SMILES | C[C@H](CCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)c(Cc3ccc(C(N)N)cc3)c2-c2ccc(O)cc2)c1)CCc1ccccc1 |
| InChI | InChI=1S/C46H52N2O5/c1-32(12-13-33-9-5-3-6-10-33)8-4-2-7-11-39(49)23-16-35-17-26-43(52)44(31-35)53-29-28-37-22-27-42(51)41(45(37)36-20-24-40(50)25-21-36)30-34-14-18-38(19-15-34)46(47)48/h3,5-7,9-11,14-15,17-22,24-27,31-32,46,50-52H,2,4,8,12-13,16,23,28-30,47-48H2,1H3/t32-/m1/s1 |
| InChIKey | BFQSJHLCVIMANV-JGCGQSQUSA-N |
| XLogP | 9.10 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|