C31H39N3O4 — CID 162840173
2-[3-[3-hydroxy-6-[(E,2R)-1-(4-hydroxy-3-methoxyphenyl)-3-oxodec-4-en-2-yl]naphthalen-1-yl]propyl]guanidine (PubChem CID 162840173) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is 2-[3-[3-hydroxy-6-[(E,2R)-1-(4-hydroxy-3-methoxyphenyl)-3-oxodec-4-en-2-yl]naphthalen-1-yl]propyl]guanidine.
| Compound Name | 2-[3-[3-hydroxy-6-[(E,2R)-1-(4-hydroxy-3-methoxyphenyl)-3-oxodec-4-en-2-yl]naphthalen-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 162840173 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 2-[3-[3-hydroxy-6-[(E,2R)-1-(4-hydroxy-3-methoxyphenyl)-3-oxodec-4-en-2-yl]naphthalen-1-yl]propyl]guanidine |
| SMILES | CCCCC/C=C/C(=O)[C@H](Cc1ccc(O)c(OC)c1)c1ccc2c(CCCN=C(N)N)cc(O)cc2c1 |
| InChI | InChI=1S/C31H39N3O4/c1-3-4-5-6-7-10-28(36)27(16-21-11-14-29(37)30(17-21)38-2)23-12-13-26-22(9-8-15-34-31(32)33)19-25(35)20-24(26)18-23/h7,10-14,17-20,27,35,37H,3-6,8-9,15-16H2,1-2H3,(H4,32,33,34)/b10-7+/t27-/m1/s1 |
| InChIKey | IDEBZXINAAFXNP-ACMAXOTASA-N |
| XLogP | 5.50 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|