C32H41NO5 — CID 150292783
[2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2Z)-docosa-2,4,6,8,10,13,15-heptaenoate (PubChem CID 150292783) has the molecular formula C32H41NO5 and a molecular weight of 519.68 g/mol. Its IUPAC name is [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2Z)-docosa-2,4,6,8,10,13,15-heptaenoate.
| Compound Name | [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2Z)-docosa-2,4,6,8,10,13,15-heptaenoate |
|---|---|
| PubChem CID | 150292783 |
| Molecular Formula | C32H41NO5 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2Z)-docosa-2,4,6,8,10,13,15-heptaenoate |
| SMILES | CCCCCCC=CC=CCC=CC=CC=CC=C/C=C\C(=O)OCC(=O)NCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C32H41NO5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-32(36)38-27-31(35)33-26-28-23-24-29(34)30(25-28)37-2/h8-11,13-25,34H,3-7,12,26-27H2,1-2H3,(H,33,35)/b9-8?,11-10?,14-13?,16-15?,18-17?,20-19?,22-21- |
| InChIKey | GHYFMRHEWLQGKZ-ZMHWNEDYSA-N |
| XLogP | 6.81 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|