C29H49NO3 — CID 70402625
2-(4-hydroxy-3-methoxyphenyl)-N-[(E)-nonadec-9-en-2-yl]propanamide (PubChem CID 70402625) has the molecular formula C29H49NO3 and a molecular weight of 459.72 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-N-[(E)-nonadec-9-en-2-yl]propanamide.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[(E)-nonadec-9-en-2-yl]propanamide |
|---|---|
| PubChem CID | 70402625 |
| Molecular Formula | C29H49NO3 |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.37 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-N-[(E)-nonadec-9-en-2-yl]propanamide |
| SMILES | CCCCCCCCC/C=C/CCCCCCC(C)NC(=O)C(C)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C29H49NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(2)30-29(32)25(3)26-21-22-27(31)28(23-26)33-4/h13-14,21-25,31H,5-12,15-20H2,1-4H3,(H,30,32)/b14-13+ |
| InChIKey | TZGSNADNOFQYFL-BUHFOSPRSA-N |
| XLogP | 8.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|