C17H27NO4 — CID 123800302
N-hydroxy-2-(4-hydroxy-3-methoxyphenyl)decanamide (PubChem CID 123800302) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-hydroxy-2-(4-hydroxy-3-methoxyphenyl)decanamide.
| Compound Name | N-hydroxy-2-(4-hydroxy-3-methoxyphenyl)decanamide |
|---|---|
| PubChem CID | 123800302 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-hydroxy-2-(4-hydroxy-3-methoxyphenyl)decanamide |
| SMILES | CCCCCCCCC(C(=O)NO)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H27NO4/c1-3-4-5-6-7-8-9-14(17(20)18-21)13-10-11-15(19)16(12-13)22-2/h10-12,14,19,21H,3-9H2,1-2H3,(H,18,20) |
| InChIKey | JGPGJMFIKYZVER-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|