C8H14N6O — CID 57358697
3-(diaminomethylidene)-1-ethyl-1-(5-methyl-1,2-oxazol-3-yl)guanidine (PubChem CID 57358697) has the molecular formula C8H14N6O and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-ethyl-1-(5-methyl-1,2-oxazol-3-yl)guanidine.
| Compound Name | 3-(diaminomethylidene)-1-ethyl-1-(5-methyl-1,2-oxazol-3-yl)guanidine |
|---|---|
| PubChem CID | 57358697 |
| Molecular Formula | C8H14N6O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-(diaminomethylidene)-1-ethyl-1-(5-methyl-1,2-oxazol-3-yl)guanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(CC)c1cc(C)on1 |
| InChI | InChI=1S/C8H14N6O/c1-3-14(8(11)12-7(9)10)6-4-5(2)15-13-6/h4H,3H2,1-2H3,(H5,9,10,11,12) |
| InChIKey | PUOJQMNPCRBTND-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|