C13H17NO4S — CID 57361534
5-ethylsulfanyl-1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene (PubChem CID 57361534) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 5-ethylsulfanyl-1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene.
| Compound Name | 5-ethylsulfanyl-1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene |
|---|---|
| PubChem CID | 57361534 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 5-ethylsulfanyl-1,3-dimethoxy-2-(2-nitroprop-1-enyl)benzene |
| SMILES | CCSc1cc(OC)c(C=C(C)[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C13H17NO4S/c1-5-19-10-7-12(17-3)11(13(8-10)18-4)6-9(2)14(15)16/h6-8H,5H2,1-4H3 |
| InChIKey | RAIRYOMGYAOICJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|