C16H23NO4 — CID 154270012
1,4-dimethoxy-2-(2-nitroprop-1-enyl)-5-pentylbenzene (PubChem CID 154270012) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(2-nitroprop-1-enyl)-5-pentylbenzene.
| Compound Name | 1,4-dimethoxy-2-(2-nitroprop-1-enyl)-5-pentylbenzene |
|---|---|
| PubChem CID | 154270012 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1,4-dimethoxy-2-(2-nitroprop-1-enyl)-5-pentylbenzene |
| SMILES | CCCCCc1cc(OC)c(C=C(C)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H23NO4/c1-5-6-7-8-13-10-16(21-4)14(11-15(13)20-3)9-12(2)17(18)19/h9-11H,5-8H2,1-4H3 |
| InChIKey | XZXBPWFVBBIIOO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|