About 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate
3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate (PubChem CID 57363379) has the molecular formula C21H23NO5
and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate.
Molecular Properties
| Compound Name | 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate |
| PubChem CID | 57363379 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate |
| SMILES | COC(=O)C(C(=O)OCc1ccccc1)=C(N)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-25-17-11-8-15(9-12-17)10-13-18(22)19(20(23)26-2)21(24)27-14-16-6-4-3-5-7-16/h3-9,11-12H,10,13-14,22H2,1-2H3 |
| InChIKey | QLGIYFGWPBWCJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate?
The IUPAC name of 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate (CID 57363379) is 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate.
What is the SMILES notation for 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate?
The canonical SMILES for 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate is COC(=O)C(C(=O)OCc1ccccc1)=C(N)CCc1ccc(OC)cc1.
What is the InChIKey of 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate?
The InChIKey is QLGIYFGWPBWCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO5/c1-25-17-11-8-15(9-12-17)10-13-18(22)19(20(23)26-2)21(24)27-14-16-6-4-3-5-7-16/h3-9,11-12H,10,13-14,22H2,1-2H3.
What are the key properties of 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate?
3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate has a molecular weight of 369.42 g/mol, XLogP of 2.76, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-benzyl 1-O-methyl 2-[1-amino-3-(4-methoxyphenyl)propylidene]propanedioate is sourced from PubChem (CID 57363379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).