About 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid
4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid (PubChem CID 57367536) has the molecular formula C20H21BO5
and a molecular weight of 352.20 g/mol. Its IUPAC name is 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid.
Molecular Properties
| Compound Name | 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid |
| PubChem CID | 57367536 |
| Molecular Formula | C20H21BO5 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid |
| SMILES | CCc1ccc(O)c(-c2ccccc2O)c1.OB(O)Oc1ccccc1 |
| InChI | InChI=1S/C14H14O2.C6H7BO3/c1-2-10-7-8-14(16)12(9-10)11-5-3-4-6-13(11)15;8-7(9)10-6-4-2-1-3-5-6/h3-9,15-16H,2H2,1H3;1-5,8-9H |
| InChIKey | YQIWJYVCHMUCON-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid?
The IUPAC name of 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid (CID 57367536) is 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid.
What is the SMILES notation for 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid?
The canonical SMILES for 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid is CCc1ccc(O)c(-c2ccccc2O)c1.OB(O)Oc1ccccc1.
What is the InChIKey of 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid?
The InChIKey is YQIWJYVCHMUCON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.C6H7BO3/c1-2-10-7-8-14(16)12(9-10)11-5-3-4-6-13(11)15;8-7(9)10-6-4-2-1-3-5-6/h3-9,15-16H,2H2,1H3;1-5,8-9H.
What are the key properties of 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid?
4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid has a molecular weight of 352.20 g/mol, XLogP of 3.36, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-(2-hydroxyphenyl)phenol;phenoxyboronic acid is sourced from PubChem (CID 57367536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).