C17H18O5S — CID 57369540
[(9S,13S,14R)-17-oxo-6,9,11,12,13,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 57369540) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is [(9S,13S,14R)-17-oxo-6,9,11,12,13,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(9S,13S,14R)-17-oxo-6,9,11,12,13,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 57369540 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | [(9S,13S,14R)-17-oxo-6,9,11,12,13,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | O=C1CC[C@H]2C3=CCc4cc(OS(=O)(=O)O)ccc4[C@H]3CC[C@H]12 |
| InChI | InChI=1S/C17H18O5S/c18-17-8-7-15-14-3-1-10-9-11(22-23(19,20)21)2-4-12(10)13(14)5-6-16(15)17/h2-4,9,13,15-16H,1,5-8H2,(H,19,20,21)/t13-,15+,16+/m1/s1 |
| InChIKey | MHPIAWFZYBZQLV-KBMXLJTQSA-N |
| XLogP | 2.82 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|