C18H21FO4S — CID 15513557
[(8S,9S,11S,13S,14S)-11-fluoro-17-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate (PubChem CID 15513557) has the molecular formula C18H21FO4S and a molecular weight of 352.43 g/mol. Its IUPAC name is [(8S,9S,11S,13S,14S)-11-fluoro-17-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate.
| Compound Name | [(8S,9S,11S,13S,14S)-11-fluoro-17-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 15513557 |
| Molecular Formula | C18H21FO4S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [(8S,9S,11S,13S,14S)-11-fluoro-17-oxo-6,7,8,9,11,12,13,14,15,16-decahydrocyclopenta[a]phenanthren-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)CC[C@H]1[C@@H]3CCC(=O)[C@H]3C[C@H](F)[C@H]21 |
| InChI | InChI=1S/C18H21FO4S/c1-24(21,22)23-11-3-5-12-10(8-11)2-4-14-13-6-7-17(20)15(13)9-16(19)18(12)14/h3,5,8,13-16,18H,2,4,6-7,9H2,1H3/t13-,14-,15-,16-,18+/m0/s1 |
| InChIKey | ZFOFRQLYANAWPK-IQWQSGHPSA-N |
| XLogP | 3.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|