C63H90N8O8-4 — CID 57371995
N-benzyl-N-[5-[1,4,12-tris[5-[benzyl(carboxylato)amino]pentyl]-1,4,8,12-tetrazacyclopentadec-8-yl]pentyl]carbamate (PubChem CID 57371995) has the molecular formula C63H90N8O8-4 and a molecular weight of 1087.46 g/mol. Its IUPAC name is N-benzyl-N-[5-[1,4,12-tris[5-[benzyl(carboxylato)amino]pentyl]-1,4,8,12-tetrazacyclopentadec-8-yl]pentyl]carbamate.
| Compound Name | N-benzyl-N-[5-[1,4,12-tris[5-[benzyl(carboxylato)amino]pentyl]-1,4,8,12-tetrazacyclopentadec-8-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 57371995 |
| Molecular Formula | C63H90N8O8-4 |
| Molecular Weight | 1087.46 g/mol |
| Exact Mass | 1086.69 |
| IUPAC Name | N-benzyl-N-[5-[1,4,12-tris[5-[benzyl(carboxylato)amino]pentyl]-1,4,8,12-tetrazacyclopentadec-8-yl]pentyl]carbamate |
| SMILES | O=C([O-])N(CCCCCN1CCCN(CCCCCN(Cc2ccccc2)C(=O)[O-])CCCN(CCCCCN(Cc2ccccc2)C(=O)[O-])CCN(CCCCCN(Cc2ccccc2)C(=O)[O-])CCC1)Cc1ccccc1 |
| InChI | InChI=1S/C63H94N8O8/c72-60(73)68(52-56-28-9-1-10-29-56)46-21-5-17-36-64-40-25-41-65(37-18-6-22-47-69(61(74)75)53-57-30-11-2-12-31-57)43-27-45-67(39-20-8-24-49-71(63(78)79)55-59-34-15-4-16-35-59)51-50-66(44-26-42-64)38-19-7-23-48-70(62(76)77)54-58-32-13-3-14-33-58/h1-4,9-16,28-35H,5-8,17-27,36-55H2,(H,72,73)(H,74,75)(H,76,77)(H,78,79)/p-4 |
| InChIKey | CTJMDRMQBBTPQT-UHFFFAOYSA-J |
| XLogP | 6.44 |
| TPSA | 186.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|