C10H20OSi — CID 57372735
(1,2-dimethylcyclohexyl)oxy-ethenylsilane (PubChem CID 57372735) has the molecular formula C10H20OSi and a molecular weight of 184.35 g/mol. Its IUPAC name is (1,2-dimethylcyclohexyl)oxy-ethenylsilane.
| Compound Name | (1,2-dimethylcyclohexyl)oxy-ethenylsilane |
|---|---|
| PubChem CID | 57372735 |
| Molecular Formula | C10H20OSi |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (1,2-dimethylcyclohexyl)oxy-ethenylsilane |
| SMILES | C=C[SiH2]OC1(C)CCCCC1C |
| InChI | InChI=1S/C10H20OSi/c1-4-12-11-10(3)8-6-5-7-9(10)2/h4,9H,1,5-8,12H2,2-3H3 |
| InChIKey | PTJCAJNADJLFRK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|