C11H24OSi — CID 57373175
(1,2-dimethylcyclohexyl)oxy-propan-2-ylsilane (PubChem CID 57373175) has the molecular formula C11H24OSi and a molecular weight of 200.40 g/mol. Its IUPAC name is (1,2-dimethylcyclohexyl)oxy-propan-2-ylsilane.
| Compound Name | (1,2-dimethylcyclohexyl)oxy-propan-2-ylsilane |
|---|---|
| PubChem CID | 57373175 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (1,2-dimethylcyclohexyl)oxy-propan-2-ylsilane |
| SMILES | CC(C)[SiH2]OC1(C)CCCCC1C |
| InChI | InChI=1S/C11H24OSi/c1-9(2)13-12-11(4)8-6-5-7-10(11)3/h9-10H,5-8,13H2,1-4H3 |
| InChIKey | RKMXGERVKMYHQK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|