C25H40O5 — CID 57372849
2-[6-(5-tetradeca-7,9,13-trienyloxolan-2-yl)dioxan-3-yl]propanoic acid (PubChem CID 57372849) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 2-[6-(5-tetradeca-7,9,13-trienyloxolan-2-yl)dioxan-3-yl]propanoic acid.
| Compound Name | 2-[6-(5-tetradeca-7,9,13-trienyloxolan-2-yl)dioxan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57372849 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 2-[6-(5-tetradeca-7,9,13-trienyloxolan-2-yl)dioxan-3-yl]propanoic acid |
| SMILES | C=CCCC=CC=CCCCCCCC1CCC(C2CCC(C(C)C(=O)O)OO2)O1 |
| InChI | InChI=1S/C25H40O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-21-16-17-23(28-21)24-19-18-22(29-30-24)20(2)25(26)27/h3,6-9,20-24H,1,4-5,10-19H2,2H3,(H,26,27) |
| InChIKey | GMDOQDZNXURJDS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|