C21H19NOSe — CID 57372994
5-(cyclohexen-1-yl)-3-phenyl-4-phenylselanyl-1,2-oxazole (PubChem CID 57372994) has the molecular formula C21H19NOSe and a molecular weight of 380.35 g/mol. Its IUPAC name is 5-(cyclohexen-1-yl)-3-phenyl-4-phenylselanyl-1,2-oxazole.
| Compound Name | 5-(cyclohexen-1-yl)-3-phenyl-4-phenylselanyl-1,2-oxazole |
|---|---|
| PubChem CID | 57372994 |
| Molecular Formula | C21H19NOSe |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 5-(cyclohexen-1-yl)-3-phenyl-4-phenylselanyl-1,2-oxazole |
| SMILES | C1=C(c2onc(-c3ccccc3)c2[Se]c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H19NOSe/c1-4-10-16(11-5-1)19-21(24-18-14-8-3-9-15-18)20(23-22-19)17-12-6-2-7-13-17/h1,3-5,8-12,14-15H,2,6-7,13H2 |
| InChIKey | GDCNYUJVVURCAY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|