C22H17NOSe — CID 71567074
5-(3-methylphenyl)-3-phenyl-4-phenylselanyl-1,2-oxazole (PubChem CID 71567074) has the molecular formula C22H17NOSe and a molecular weight of 390.34 g/mol. Its IUPAC name is 5-(3-methylphenyl)-3-phenyl-4-phenylselanyl-1,2-oxazole.
| Compound Name | 5-(3-methylphenyl)-3-phenyl-4-phenylselanyl-1,2-oxazole |
|---|---|
| PubChem CID | 71567074 |
| Molecular Formula | C22H17NOSe |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 5-(3-methylphenyl)-3-phenyl-4-phenylselanyl-1,2-oxazole |
| SMILES | Cc1cccc(-c2onc(-c3ccccc3)c2[Se]c2ccccc2)c1 |
| InChI | InChI=1S/C22H17NOSe/c1-16-9-8-12-18(15-16)21-22(25-19-13-6-3-7-14-19)20(23-24-21)17-10-4-2-5-11-17/h2-15H,1H3 |
| InChIKey | OTGASUGTHAUKJU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|