C13H24NO4S- — CID 57373653
N-tert-butyl-N-[(3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]carbamate (PubChem CID 57373653) has the molecular formula C13H24NO4S- and a molecular weight of 290.41 g/mol. Its IUPAC name is N-tert-butyl-N-[(3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]carbamate.
| Compound Name | N-tert-butyl-N-[(3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 57373653 |
| Molecular Formula | C13H24NO4S- |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-tert-butyl-N-[(3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]carbamate |
| SMILES | CC(C)C[C@@H](C=CS(C)(=O)=O)N(C(=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C13H25NO4S/c1-10(2)9-11(7-8-19(6,17)18)14(12(15)16)13(3,4)5/h7-8,10-11H,9H2,1-6H3,(H,15,16)/p-1/t11-/m1/s1 |
| InChIKey | YWIBNKQZEDBEAS-LLVKDONJSA-M |
| XLogP | 1.40 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |