C11H21NO3S — CID 157320567
N-[(E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]propanamide (PubChem CID 157320567) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[(E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]propanamide.
| Compound Name | N-[(E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]propanamide |
|---|---|
| PubChem CID | 157320567 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[(E,3S)-5-methyl-1-methylsulfonylhex-1-en-3-yl]propanamide |
| SMILES | CCC(=O)N[C@H](/C=C/S(C)(=O)=O)CC(C)C |
| InChI | InChI=1S/C11H21NO3S/c1-5-11(13)12-10(8-9(2)3)6-7-16(4,14)15/h6-7,9-10H,5,8H2,1-4H3,(H,12,13)/b7-6+/t10-/m1/s1 |
| InChIKey | BECPXPCYKWZDKQ-VQCYPWCPSA-N |
| XLogP | 1.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |