C9H15NO3S — CID 56849755
(E,3S)-3-isocyanato-5-methyl-1-methylsulfonylhex-1-ene (PubChem CID 56849755) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is (E,3S)-3-isocyanato-5-methyl-1-methylsulfonylhex-1-ene.
| Compound Name | (E,3S)-3-isocyanato-5-methyl-1-methylsulfonylhex-1-ene |
|---|---|
| PubChem CID | 56849755 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | (E,3S)-3-isocyanato-5-methyl-1-methylsulfonylhex-1-ene |
| SMILES | CC(C)C[C@@H](/C=C/S(C)(=O)=O)N=C=O |
| InChI | InChI=1S/C9H15NO3S/c1-8(2)6-9(10-7-11)4-5-14(3,12)13/h4-5,8-9H,6H2,1-3H3/b5-4+/t9-/m1/s1 |
| InChIKey | IIHFYULJIYAOER-XNPJLODASA-N |
| XLogP | 1.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|