C19H22N2O4 — CID 57373842
4-methyl-2-nitro-3-(3-phenylmethoxybutyl)benzamide (PubChem CID 57373842) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-methyl-2-nitro-3-(3-phenylmethoxybutyl)benzamide.
| Compound Name | 4-methyl-2-nitro-3-(3-phenylmethoxybutyl)benzamide |
|---|---|
| PubChem CID | 57373842 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-methyl-2-nitro-3-(3-phenylmethoxybutyl)benzamide |
| SMILES | Cc1ccc(C(N)=O)c([N+](=O)[O-])c1CCC(C)OCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O4/c1-13-8-10-17(19(20)22)18(21(23)24)16(13)11-9-14(2)25-12-15-6-4-3-5-7-15/h3-8,10,14H,9,11-12H2,1-2H3,(H2,20,22) |
| InChIKey | FFOSALAHLIBQIO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|