C16H21Cl3O4 — CID 57376295
1-butoxypropyl 2-(2,4,5-trichlorophenoxy)propanoate (PubChem CID 57376295) has the molecular formula C16H21Cl3O4 and a molecular weight of 383.70 g/mol. Its IUPAC name is 1-butoxypropyl 2-(2,4,5-trichlorophenoxy)propanoate.
| Compound Name | 1-butoxypropyl 2-(2,4,5-trichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 57376295 |
| Molecular Formula | C16H21Cl3O4 |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 1-butoxypropyl 2-(2,4,5-trichlorophenoxy)propanoate |
| SMILES | CCCCOC(CC)OC(=O)C(C)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl3O4/c1-4-6-7-21-15(5-2)23-16(20)10(3)22-14-9-12(18)11(17)8-13(14)19/h8-10,15H,4-7H2,1-3H3 |
| InChIKey | XBDDJOFNRDPALB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|