About tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate
tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate (PubChem CID 57382703) has the molecular formula C27H39NO2Si
and a molecular weight of 437.70 g/mol. Its IUPAC name is tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate.
Molecular Properties
| Compound Name | tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate |
| PubChem CID | 57382703 |
| Molecular Formula | C27H39NO2Si |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate |
| SMILES | C=Cc1cccc(C)c1CN(Cc1ccccc1)C(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H39NO2Si/c1-9-25-17-13-14-23(8)26(25)19-28(18-24-15-11-10-12-16-24)27(29)30-31(20(2)3,21(4)5)22(6)7/h9-17,20-22H,1,18-19H2,2-8H3 |
| InChIKey | QPKXPYAQSZUPIU-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate?
The IUPAC name of tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate (CID 57382703) is tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate.
What is the SMILES notation for tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate?
The canonical SMILES for tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate is C=Cc1cccc(C)c1CN(Cc1ccccc1)C(=O)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate?
The InChIKey is QPKXPYAQSZUPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H39NO2Si/c1-9-25-17-13-14-23(8)26(25)19-28(18-24-15-11-10-12-16-24)27(29)30-31(20(2)3,21(4)5)22(6)7/h9-17,20-22H,1,18-19H2,2-8H3.
What are the key properties of tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate?
tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate has a molecular weight of 437.70 g/mol, XLogP of 7.95, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)silyl N-benzyl-N-[(2-ethenyl-6-methylphenyl)methyl]carbamate is sourced from PubChem (CID 57382703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).