C22H37NO2Si — CID 57382243
tri(propan-2-yl)silyl N-benzyl-N-pent-4-enylcarbamate (PubChem CID 57382243) has the molecular formula C22H37NO2Si and a molecular weight of 375.63 g/mol. Its IUPAC name is tri(propan-2-yl)silyl N-benzyl-N-pent-4-enylcarbamate.
| Compound Name | tri(propan-2-yl)silyl N-benzyl-N-pent-4-enylcarbamate |
|---|---|
| PubChem CID | 57382243 |
| Molecular Formula | C22H37NO2Si |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | tri(propan-2-yl)silyl N-benzyl-N-pent-4-enylcarbamate |
| SMILES | C=CCCCN(Cc1ccccc1)C(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H37NO2Si/c1-8-9-13-16-23(17-21-14-11-10-12-15-21)22(24)25-26(18(2)3,19(4)5)20(6)7/h8,10-12,14-15,18-20H,1,9,13,16-17H2,2-7H3 |
| InChIKey | YSTSTRPGKUJTGE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|