C17H25N3O3 — CID 70247516
[(2S)-3-methyl-1-oxo-1-[pent-4-enyl(pyridin-3-ylmethyl)amino]butan-2-yl]carbamic acid (PubChem CID 70247516) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-[pent-4-enyl(pyridin-3-ylmethyl)amino]butan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-methyl-1-oxo-1-[pent-4-enyl(pyridin-3-ylmethyl)amino]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 70247516 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-[pent-4-enyl(pyridin-3-ylmethyl)amino]butan-2-yl]carbamic acid |
| SMILES | C=CCCCN(Cc1cccnc1)C(=O)[C@@H](NC(=O)O)C(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-4-5-6-10-20(12-14-8-7-9-18-11-14)16(21)15(13(2)3)19-17(22)23/h4,7-9,11,13,15,19H,1,5-6,10,12H2,2-3H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | GJMUSEOPPXZMEN-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|