C21H35NO3Si — CID 57381809
tri(propan-2-yl)silyl N-benzyl-N-(4-oxobutyl)carbamate (PubChem CID 57381809) has the molecular formula C21H35NO3Si and a molecular weight of 377.60 g/mol. Its IUPAC name is tri(propan-2-yl)silyl N-benzyl-N-(4-oxobutyl)carbamate.
| Compound Name | tri(propan-2-yl)silyl N-benzyl-N-(4-oxobutyl)carbamate |
|---|---|
| PubChem CID | 57381809 |
| Molecular Formula | C21H35NO3Si |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tri(propan-2-yl)silyl N-benzyl-N-(4-oxobutyl)carbamate |
| SMILES | CC(C)[Si](OC(=O)N(CCCC=O)Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H35NO3Si/c1-17(2)26(18(3)4,19(5)6)25-21(24)22(14-10-11-15-23)16-20-12-8-7-9-13-20/h7-9,12-13,15,17-19H,10-11,14,16H2,1-6H3 |
| InChIKey | SCGAKIZGZMTHAR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|