C17H19N3O — CID 57389063
8,8-dimethyl-2-(3-methylanilino)-6,7-dihydroquinazolin-5-one (PubChem CID 57389063) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 8,8-dimethyl-2-(3-methylanilino)-6,7-dihydroquinazolin-5-one.
| Compound Name | 8,8-dimethyl-2-(3-methylanilino)-6,7-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 57389063 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 8,8-dimethyl-2-(3-methylanilino)-6,7-dihydroquinazolin-5-one |
| SMILES | Cc1cccc(Nc2ncc3c(n2)C(C)(C)CCC3=O)c1 |
| InChI | InChI=1S/C17H19N3O/c1-11-5-4-6-12(9-11)19-16-18-10-13-14(21)7-8-17(2,3)15(13)20-16/h4-6,9-10H,7-8H2,1-3H3,(H,18,19,20) |
| InChIKey | LKNXEXHWNWMONZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |