C22H27N3O6S — CID 57391406
4-[[2-[(3-phenoxyphenyl)methylsulfamoylamino]acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 57391406) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 4-[[2-[(3-phenoxyphenyl)methylsulfamoylamino]acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-[(3-phenoxyphenyl)methylsulfamoylamino]acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 57391406 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 4-[[2-[(3-phenoxyphenyl)methylsulfamoylamino]acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CNS(=O)(=O)NCc1cccc(Oc2ccccc2)c1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C22H27N3O6S/c26-21(25-18-11-9-17(10-12-18)22(27)28)15-24-32(29,30)23-14-16-5-4-8-20(13-16)31-19-6-2-1-3-7-19/h1-8,13,17-18,23-24H,9-12,14-15H2,(H,25,26)(H,27,28) |
| InChIKey | BREBOVQVSLZNSU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |