C29H36O6 — CID 57400024
benzyl (1R,4S,5R,9R,10S,13R)-13-acetyloxy-5,9-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-5-carboxylate (PubChem CID 57400024) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is benzyl (1R,4S,5R,9R,10S,13R)-13-acetyloxy-5,9-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-5-carboxylate.
| Compound Name | benzyl (1R,4S,5R,9R,10S,13R)-13-acetyloxy-5,9-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-5-carboxylate |
|---|---|
| PubChem CID | 57400024 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | benzyl (1R,4S,5R,9R,10S,13R)-13-acetyloxy-5,9-dimethyl-14-methylidene-15-oxo-16-oxatetracyclo[11.3.1.01,10.04,9]heptadecane-5-carboxylate |
| SMILES | C=C1C(=O)O[C@@]23CC[C@H]4[C@@](C)(CCC[C@@]4(C)C(=O)OCc4ccccc4)[C@@H]2CC[C@@]1(OC(C)=O)C3 |
| InChI | InChI=1S/C29H36O6/c1-19-24(31)35-29-16-11-22-26(3,23(29)12-15-28(19,18-29)34-20(2)30)13-8-14-27(22,4)25(32)33-17-21-9-6-5-7-10-21/h5-7,9-10,22-23H,1,8,11-18H2,2-4H3/t22-,23-,26+,27+,28+,29+/m0/s1 |
| InChIKey | GERIUYAFAWSXDV-RTOATVDPSA-N |
| XLogP | 5.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|