C40H39N3O8 — CID 57401926
2-[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]benzoyl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate (PubChem CID 57401926) has the molecular formula C40H39N3O8 and a molecular weight of 689.77 g/mol. Its IUPAC name is 2-[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]benzoyl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate.
| Compound Name | 2-[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]benzoyl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 57401926 |
| Molecular Formula | C40H39N3O8 |
| Molecular Weight | 689.77 g/mol |
| Exact Mass | 689.27 |
| IUPAC Name | 2-[4-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)methoxy]benzoyl]oxyethyl 4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoate |
| SMILES | CC1(C)CCC(C)(C)c2cc(NC(=O)c3ccc(C(=O)OCCOC(=O)c4ccc(OCc5c(-c6ccccc6)no[n+]5[O-])cc4)cc3)ccc21 |
| InChI | InChI=1S/C40H39N3O8/c1-39(2)20-21-40(3,4)33-24-30(16-19-32(33)39)41-36(44)27-10-12-28(13-11-27)37(45)48-22-23-49-38(46)29-14-17-31(18-15-29)50-25-34-35(42-51-43(34)47)26-8-6-5-7-9-26/h5-19,24H,20-23,25H2,1-4H3,(H,41,44) |
| InChIKey | DZFDOACLJYNKCG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|