C19H22N2O7S — CID 57401935
methyl 2-[[(5-acetamido-2,4-dimethoxyphenyl)sulfonylamino]methyl]benzoate (PubChem CID 57401935) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is methyl 2-[[(5-acetamido-2,4-dimethoxyphenyl)sulfonylamino]methyl]benzoate.
| Compound Name | methyl 2-[[(5-acetamido-2,4-dimethoxyphenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 57401935 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | methyl 2-[[(5-acetamido-2,4-dimethoxyphenyl)sulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CNS(=O)(=O)c1cc(NC(C)=O)c(OC)cc1OC |
| InChI | InChI=1S/C19H22N2O7S/c1-12(22)21-15-9-18(17(27-3)10-16(15)26-2)29(24,25)20-11-13-7-5-6-8-14(13)19(23)28-4/h5-10,20H,11H2,1-4H3,(H,21,22) |
| InChIKey | PZYFKJRPNGVDHR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |