C22H23N3O5S — CID 71497196
N-[5-[(4-aminophenyl)-phenylsulfamoyl]-2,4-dimethoxyphenyl]acetamide (PubChem CID 71497196) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[5-[(4-aminophenyl)-phenylsulfamoyl]-2,4-dimethoxyphenyl]acetamide.
| Compound Name | N-[5-[(4-aminophenyl)-phenylsulfamoyl]-2,4-dimethoxyphenyl]acetamide |
|---|---|
| PubChem CID | 71497196 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[5-[(4-aminophenyl)-phenylsulfamoyl]-2,4-dimethoxyphenyl]acetamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)N(c2ccccc2)c2ccc(N)cc2)cc1NC(C)=O |
| InChI | InChI=1S/C22H23N3O5S/c1-15(26)24-19-13-22(21(30-3)14-20(19)29-2)31(27,28)25(17-7-5-4-6-8-17)18-11-9-16(23)10-12-18/h4-14H,23H2,1-3H3,(H,24,26) |
| InChIKey | VCFXWRVLXIHUFN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|