C15H6F3N5O4S2 — CID 57403573
(5Z)-5-[[6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 57403573) has the molecular formula C15H6F3N5O4S2 and a molecular weight of 441.37 g/mol. Its IUPAC name is (5Z)-5-[[6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 57403573 |
| Molecular Formula | C15H6F3N5O4S2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | (5Z)-5-[[6-(4-nitrophenyl)-2-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2c(-c3ccc([N+](=O)[O-])cc3)nc3sc(C(F)(F)F)nn23)S1 |
| InChI | InChI=1S/C15H6F3N5O4S2/c16-15(17,18)12-21-22-8(5-9-11(24)20-14(25)28-9)10(19-13(22)29-12)6-1-3-7(4-2-6)23(26)27/h1-5H,(H,20,24,25)/b9-5- |
| InChIKey | UGVQJVDPMPHSSN-UITAMQMPSA-N |
| XLogP | 3.71 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|