C19H12N4O3S3 — CID 72793647
(5Z)-5-[[6-(4-methoxyphenyl)-2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 72793647) has the molecular formula C19H12N4O3S3 and a molecular weight of 440.53 g/mol. Its IUPAC name is (5Z)-5-[[6-(4-methoxyphenyl)-2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[6-(4-methoxyphenyl)-2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 72793647 |
| Molecular Formula | C19H12N4O3S3 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | (5Z)-5-[[6-(4-methoxyphenyl)-2-thiophen-2-ylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2nc3sc(-c4cccs4)nn3c2/C=C2\SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C19H12N4O3S3/c1-26-11-6-4-10(5-7-11)15-12(9-14-16(24)21-19(25)28-14)23-18(20-15)29-17(22-23)13-3-2-8-27-13/h2-9H,1H3,(H,21,24,25)/b14-9- |
| InChIKey | LQLHZUPPBDYDRL-ZROIWOOFSA-N |
| XLogP | 4.52 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|