C28H26F3N3O5 — CID 57410327
4-(4-propan-2-ylbenzoyl)-1-(6-propan-2-yloxypyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 57410327) has the molecular formula C28H26F3N3O5 and a molecular weight of 541.53 g/mol. Its IUPAC name is 4-(4-propan-2-ylbenzoyl)-1-(6-propan-2-yloxypyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 4-(4-propan-2-ylbenzoyl)-1-(6-propan-2-yloxypyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 57410327 |
| Molecular Formula | C28H26F3N3O5 |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 4-(4-propan-2-ylbenzoyl)-1-(6-propan-2-yloxypyridazin-3-yl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CC(C)Oc1ccc(N2C(=O)C(=O)C(C(=O)c3ccc(C(C)C)cc3)C2c2ccc(OC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C28H26F3N3O5/c1-15(2)17-5-7-19(8-6-17)25(35)23-24(18-9-11-20(12-10-18)39-28(29,30)31)34(27(37)26(23)36)21-13-14-22(33-32-21)38-16(3)4/h5-16,23-24H,1-4H3 |
| InChIKey | ANUBHOUIDGBXLO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|