C28H26F3N3O6 — CID 57410330
1-[6-(2-methoxyethoxy)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 57410330) has the molecular formula C28H26F3N3O6 and a molecular weight of 557.53 g/mol. Its IUPAC name is 1-[6-(2-methoxyethoxy)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 1-[6-(2-methoxyethoxy)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 57410330 |
| Molecular Formula | C28H26F3N3O6 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 1-[6-(2-methoxyethoxy)pyridazin-3-yl]-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | COCCOc1ccc(N2C(=O)C(=O)C(C(=O)c3ccc(C(C)C)cc3)C2c2ccc(OC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C28H26F3N3O6/c1-16(2)17-4-6-19(7-5-17)25(35)23-24(18-8-10-20(11-9-18)40-28(29,30)31)34(27(37)26(23)36)21-12-13-22(33-32-21)39-15-14-38-3/h4-13,16,23-24H,14-15H2,1-3H3 |
| InChIKey | FLOFHKVNENRHSD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|