C31H24F3N3O4S — CID 57410329
1-(6-phenylsulfanylpyridazin-3-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 57410329) has the molecular formula C31H24F3N3O4S and a molecular weight of 591.61 g/mol. Its IUPAC name is 1-(6-phenylsulfanylpyridazin-3-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | 1-(6-phenylsulfanylpyridazin-3-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 57410329 |
| Molecular Formula | C31H24F3N3O4S |
| Molecular Weight | 591.61 g/mol |
| Exact Mass | 591.14 |
| IUPAC Name | 1-(6-phenylsulfanylpyridazin-3-yl)-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | CC(C)c1ccc(C(=O)C2C(=O)C(=O)N(c3ccc(Sc4ccccc4)nn3)C2c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H24F3N3O4S/c1-18(2)19-8-10-21(11-9-19)28(38)26-27(20-12-14-22(15-13-20)41-31(32,33)34)37(30(40)29(26)39)24-16-17-25(36-35-24)42-23-6-4-3-5-7-23/h3-18,26-27H,1-2H3 |
| InChIKey | PSYCKAWFALUHEK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|