C27H25F3N4O6S — CID 57410578
N-[[6-[2,3-dioxo-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidin-1-yl]pyridazin-3-yl]methyl]methanesulfonamide (PubChem CID 57410578) has the molecular formula C27H25F3N4O6S and a molecular weight of 590.58 g/mol. Its IUPAC name is N-[[6-[2,3-dioxo-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidin-1-yl]pyridazin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[6-[2,3-dioxo-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidin-1-yl]pyridazin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 57410578 |
| Molecular Formula | C27H25F3N4O6S |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | N-[[6-[2,3-dioxo-4-(4-propan-2-ylbenzoyl)-5-[4-(trifluoromethoxy)phenyl]pyrrolidin-1-yl]pyridazin-3-yl]methyl]methanesulfonamide |
| SMILES | CC(C)c1ccc(C(=O)C2C(=O)C(=O)N(c3ccc(CNS(C)(=O)=O)nn3)C2c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H25F3N4O6S/c1-15(2)16-4-6-18(7-5-16)24(35)22-23(17-8-11-20(12-9-17)40-27(28,29)30)34(26(37)25(22)36)21-13-10-19(32-33-21)14-31-41(3,38)39/h4-13,15,22-23,31H,14H2,1-3H3 |
| InChIKey | OUVPIUPGLCQADO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|