About CID 57412256
CID 57412256 (PubChem CID 57412256) has the molecular formula C27H22BrN3O4
and a molecular weight of 532.39 g/mol.
Molecular Properties
| Compound Name | CID 57412256 |
| PubChem CID | 57412256 |
| Molecular Formula | C27H22BrN3O4 |
| Molecular Weight | 532.39 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1N[C@@]2(C(=O)Nc3ccc(C)cc32)[C@]2(C(=O)Nc3ccccc32)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H22BrN3O4/c1-14-7-12-20-18(13-14)27(25(34)30-20)26(17-5-3-4-6-19(17)29-24(26)33)21(22(31-27)23(32)35-2)15-8-10-16(28)11-9-15/h3-13,21-22,31H,1-2H3,(H,29,33)(H,30,34)/t21-,22+,26-,27-/m0/s1 |
| InChIKey | WSJUPHOPEMCLSG-ZKBLBJRCSA-N |
| XLogP | 3.72 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 532.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 57412256 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57412256?
The IUPAC name of CID 57412256 (CID 57412256) is not available.
What is the SMILES notation for CID 57412256?
The canonical SMILES for CID 57412256 is COC(=O)[C@@H]1N[C@@]2(C(=O)Nc3ccc(C)cc32)[C@]2(C(=O)Nc3ccccc32)[C@H]1c1ccc(Br)cc1.
What is the InChIKey of CID 57412256?
The InChIKey is WSJUPHOPEMCLSG-ZKBLBJRCSA-N. The full InChI is InChI=1S/C27H22BrN3O4/c1-14-7-12-20-18(13-14)27(25(34)30-20)26(17-5-3-4-6-19(17)29-24(26)33)21(22(31-27)23(32)35-2)15-8-10-16(28)11-9-15/h3-13,21-22,31H,1-2H3,(H,29,33)(H,30,34)/t21-,22+,26-,27-/m0/s1.
What are the key properties of CID 57412256?
CID 57412256 has a molecular weight of 532.39 g/mol, XLogP of 3.72, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57412256 is sourced from PubChem (CID 57412256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).