About CID 57413508
CID 57413508 (PubChem CID 57413508) has the molecular formula C28H24BrN3O4
and a molecular weight of 546.42 g/mol.
Molecular Properties
| Compound Name | CID 57413508 |
| PubChem CID | 57413508 |
| Molecular Formula | C28H24BrN3O4 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | — |
| SMILES | CCN1C(=O)[C@@]2(N[C@@H](C(=O)OC)[C@H](c3ccc(Br)cc3)[C@@]23C(=O)Nc2ccccc23)c2ccccc21 |
| InChI | InChI=1S/C28H24BrN3O4/c1-3-32-21-11-7-5-9-19(21)28(26(32)35)27(18-8-4-6-10-20(18)30-25(27)34)22(23(31-28)24(33)36-2)16-12-14-17(29)15-13-16/h4-15,22-23,31H,3H2,1-2H3,(H,30,34)/t22-,23+,27-,28-/m0/s1 |
| InChIKey | ACEZKKHXVGNSKZ-NPLHHVMXSA-N |
| XLogP | 3.83 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 57413508 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57413508?
The IUPAC name of CID 57413508 (CID 57413508) is not available.
What is the SMILES notation for CID 57413508?
The canonical SMILES for CID 57413508 is CCN1C(=O)[C@@]2(N[C@@H](C(=O)OC)[C@H](c3ccc(Br)cc3)[C@@]23C(=O)Nc2ccccc23)c2ccccc21.
What is the InChIKey of CID 57413508?
The InChIKey is ACEZKKHXVGNSKZ-NPLHHVMXSA-N. The full InChI is InChI=1S/C28H24BrN3O4/c1-3-32-21-11-7-5-9-19(21)28(26(32)35)27(18-8-4-6-10-20(18)30-25(27)34)22(23(31-28)24(33)36-2)16-12-14-17(29)15-13-16/h4-15,22-23,31H,3H2,1-2H3,(H,30,34)/t22-,23+,27-,28-/m0/s1.
What are the key properties of CID 57413508?
CID 57413508 has a molecular weight of 546.42 g/mol, XLogP of 3.83, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57413508 is sourced from PubChem (CID 57413508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).