C16H18BrNO4S — CID 57412331
(5Z)-5-[(5-bromo-2,3-dihydroxyphenyl)methylidene]-3-(2-ethylbutyl)-1,3-thiazolidine-2,4-dione (PubChem CID 57412331) has the molecular formula C16H18BrNO4S and a molecular weight of 400.29 g/mol. Its IUPAC name is (5Z)-5-[(5-bromo-2,3-dihydroxyphenyl)methylidene]-3-(2-ethylbutyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(5-bromo-2,3-dihydroxyphenyl)methylidene]-3-(2-ethylbutyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 57412331 |
| Molecular Formula | C16H18BrNO4S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (5Z)-5-[(5-bromo-2,3-dihydroxyphenyl)methylidene]-3-(2-ethylbutyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCC(CC)CN1C(=O)S/C(=C\c2cc(Br)cc(O)c2O)C1=O |
| InChI | InChI=1S/C16H18BrNO4S/c1-3-9(4-2)8-18-15(21)13(23-16(18)22)6-10-5-11(17)7-12(19)14(10)20/h5-7,9,19-20H,3-4,8H2,1-2H3/b13-6- |
| InChIKey | VQAORCSTSHGADL-MLPAPPSSSA-N |
| XLogP | 4.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|