C12H7BrNO5S- — CID 7321007
2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 7321007) has the molecular formula C12H7BrNO5S- and a molecular weight of 357.16 g/mol. Its IUPAC name is 2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 7321007 |
| Molecular Formula | C12H7BrNO5S- |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | 2-[(5E)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | O=C([O-])CN1C(=O)S/C(=C/c2cc(Br)ccc2O)C1=O |
| InChI | InChI=1S/C12H8BrNO5S/c13-7-1-2-8(15)6(3-7)4-9-11(18)14(5-10(16)17)12(19)20-9/h1-4,15H,5H2,(H,16,17)/p-1/b9-4+ |
| InChIKey | HTGKOZGPGWNHJE-RUDMXATFSA-M |
| XLogP | 0.94 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|