C28H35N3O2 — CID 57412942
(1R,9R,10R)-17-(cyclobutylmethyl)-N-[(3-nitrophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 57412942) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(3-nitrophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(3-nitrophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 57412942 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(3-nitrophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@@H](C3)N(CC2CCC2)CC4)c1 |
| InChI | InChI=1S/C28H35N3O2/c32-31(33)24-8-4-7-21(15-24)18-29-23-11-10-22-16-27-25-9-1-2-12-28(25,26(22)17-23)13-14-30(27)19-20-5-3-6-20/h4,7-8,10-11,15,17,20,25,27,29H,1-3,5-6,9,12-14,16,18-19H2/t25-,27+,28+/m0/s1 |
| InChIKey | ZONATBMJYVOZDG-KJYTXNCISA-N |
| XLogP | 6.07 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|