C25H28N8O2 — CID 57414968
2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-6-[(4,6-dimethylquinazolin-2-yl)methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-dione (PubChem CID 57414968) has the molecular formula C25H28N8O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-6-[(4,6-dimethylquinazolin-2-yl)methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-dione.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-6-[(4,6-dimethylquinazolin-2-yl)methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 57414968 |
| Molecular Formula | C25H28N8O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-3-but-2-ynyl-6-[(4,6-dimethylquinazolin-2-yl)methyl]-[1,2,4]triazolo[1,5-c]pyrimidine-5,7-dione |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2cc(=O)n(Cc3nc(C)c4cc(C)ccc4n3)c(=O)n21 |
| InChI | InChI=1S/C25H28N8O2/c1-4-5-11-32-24(30-10-6-7-18(26)14-30)29-22-13-23(34)31(25(35)33(22)32)15-21-27-17(3)19-12-16(2)8-9-20(19)28-21/h8-9,12-13,18H,6-7,10-11,14-15,26H2,1-3H3/t18-/m1/s1 |
| InChIKey | HOLNAWUMCXGOPJ-GOSISDBHSA-N |
| XLogP | 1.22 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|