About 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine
5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 57416059) has the molecular formula C7H6ClN3S
and a molecular weight of 199.67 g/mol. Its IUPAC name is 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine.
Analyze 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
The IUPAC name of 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine (CID 57416059) is 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine.
What is the SMILES notation for 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
The canonical SMILES for 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine is CSc1ncc2c(Cl)ccn2n1.
What is the InChIKey of 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
The InChIKey is LKBSITYDHRQFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3S/c1-12-7-9-4-6-5(8)2-3-11(6)10-7/h2-4H,1H3.
What are the key properties of 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine?
5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine has a molecular weight of 199.67 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methylsulfanylpyrrolo[2,1-f][1,2,4]triazine is sourced from PubChem (CID 57416059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).