C5H13NO4S — CID 57419763
1,3-dimethoxy-2-(sulfinoamino)propane (PubChem CID 57419763) has the molecular formula C5H13NO4S and a molecular weight of 183.23 g/mol. Its IUPAC name is 1,3-dimethoxy-2-(sulfinoamino)propane.
| Compound Name | 1,3-dimethoxy-2-(sulfinoamino)propane |
|---|---|
| PubChem CID | 57419763 |
| Molecular Formula | C5H13NO4S |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 1,3-dimethoxy-2-(sulfinoamino)propane |
| SMILES | COCC(COC)NS(=O)O |
| InChI | InChI=1S/C5H13NO4S/c1-9-3-5(4-10-2)6-11(7)8/h5-6H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | DWHUWMGYXXNRGP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|