C17H14Cl2N2O4 — CID 57425002
(2S)-2-[2,4-dichloro-5-(2-methylindazol-3-yl)oxyphenoxy]propanoic acid (PubChem CID 57425002) has the molecular formula C17H14Cl2N2O4 and a molecular weight of 381.22 g/mol. Its IUPAC name is (2S)-2-[2,4-dichloro-5-(2-methylindazol-3-yl)oxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2,4-dichloro-5-(2-methylindazol-3-yl)oxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 57425002 |
| Molecular Formula | C17H14Cl2N2O4 |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | (2S)-2-[2,4-dichloro-5-(2-methylindazol-3-yl)oxyphenoxy]propanoic acid |
| SMILES | C[C@H](Oc1cc(Oc2c3ccccc3nn2C)c(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C17H14Cl2N2O4/c1-9(17(22)23)24-14-8-15(12(19)7-11(14)18)25-16-10-5-3-4-6-13(10)20-21(16)2/h3-9H,1-2H3,(H,22,23)/t9-/m0/s1 |
| InChIKey | JZAWXUSXBHUVRC-VIFPVBQESA-N |
| XLogP | 4.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |